C28H31N — CID 158888282
aniline;1-benzyl-4-methylbenzene;1,4-xylene (PubChem CID 158888282) has the molecular formula C28H31N and a molecular weight of 381.56 g/mol. Its IUPAC name is aniline;1-benzyl-4-methylbenzene;1,4-xylene.
| Compound Name | aniline;1-benzyl-4-methylbenzene;1,4-xylene |
|---|---|
| PubChem CID | 158888282 |
| Molecular Formula | C28H31N |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | aniline;1-benzyl-4-methylbenzene;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1ccc(Cc2ccccc2)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C14H14.C8H10.C6H7N/c1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13;1-7-3-5-8(2)6-4-7;7-6-4-2-1-3-5-6/h2-10H,11H2,1H3;3-6H,1-2H3;1-5H,7H2 |
| InChIKey | JDXADNGGWYHHAH-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|