About benzylbenzene;propane;toluene
benzylbenzene;propane;toluene (PubChem CID 90753545) has the molecular formula C29H44
and a molecular weight of 392.67 g/mol. Its IUPAC name is benzylbenzene;propane;toluene.
Molecular Properties
| Compound Name | benzylbenzene;propane;toluene |
| PubChem CID | 90753545 |
| Molecular Formula | C29H44 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | benzylbenzene;propane;toluene |
| SMILES | CCC.CCC.CCC.Cc1ccccc1.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C7H8.3C3H8/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-7-5-3-2-4-6-7;3*1-3-2/h1-10H,11H2;2-6H,1H3;3*3H2,1-2H3 |
| InChIKey | SPIPPIAKUZPKNA-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzylbenzene;propane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;propane;toluene?
The IUPAC name of benzylbenzene;propane;toluene (CID 90753545) is benzylbenzene;propane;toluene.
What is the SMILES notation for benzylbenzene;propane;toluene?
The canonical SMILES for benzylbenzene;propane;toluene is CCC.CCC.CCC.Cc1ccccc1.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;propane;toluene?
The InChIKey is SPIPPIAKUZPKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C7H8.3C3H8/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-7-5-3-2-4-6-7;3*1-3-2/h1-10H,11H2;2-6H,1H3;3*3H2,1-2H3.
What are the key properties of benzylbenzene;propane;toluene?
benzylbenzene;propane;toluene has a molecular weight of 392.67 g/mol, XLogP of 9.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;propane;toluene is sourced from PubChem (CID 90753545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).