C26H34 — CID 161043198
1-methyl-4-[(4-methylphenyl)methyl]benzene;propane;1,4-xylene (PubChem CID 161043198) has the molecular formula C26H34 and a molecular weight of 346.56 g/mol. Its IUPAC name is 1-methyl-4-[(4-methylphenyl)methyl]benzene;propane;1,4-xylene.
| Compound Name | 1-methyl-4-[(4-methylphenyl)methyl]benzene;propane;1,4-xylene |
|---|---|
| PubChem CID | 161043198 |
| Molecular Formula | C26H34 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 1-methyl-4-[(4-methylphenyl)methyl]benzene;propane;1,4-xylene |
| SMILES | CCC.Cc1ccc(C)cc1.Cc1ccc(Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H16.C8H10.C3H8/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-7-3-5-8(2)6-4-7;1-3-2/h3-10H,11H2,1-2H3;3-6H,1-2H3;3H2,1-2H3 |
| InChIKey | UBDLKOUVQCFYER-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |