About 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane
1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane (PubChem CID 91507263) has the molecular formula C15H16F5P
and a molecular weight of 322.26 g/mol. Its IUPAC name is 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane.
Molecular Properties
| Compound Name | 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane |
| PubChem CID | 91507263 |
| Molecular Formula | C15H16F5P |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane |
| SMILES | Cc1ccc(Cc2ccc(C)cc2)cc1.FP(F)(F)(F)F |
| InChI | InChI=1S/C15H16.F5P/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-6(2,3,4)5/h3-10H,11H2,1-2H3; |
| InChIKey | UVXOXXKOVXUVBV-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane?
The IUPAC name of 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane (CID 91507263) is 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane.
What is the SMILES notation for 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane?
The canonical SMILES for 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane is Cc1ccc(Cc2ccc(C)cc2)cc1.FP(F)(F)(F)F.
What is the InChIKey of 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane?
The InChIKey is UVXOXXKOVXUVBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.F5P/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-6(2,3,4)5/h3-10H,11H2,1-2H3;.
What are the key properties of 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane?
1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane has a molecular weight of 322.26 g/mol, XLogP of 6.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(4-methylphenyl)methyl]benzene;pentafluoro-λ5-phosphane is sourced from PubChem (CID 91507263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).