C39H36BrN — CID 161391373
1-bromo-4-phenylbenzene;4-methylaniline;1-methyl-4-[(4-phenylphenyl)methyl]benzene (PubChem CID 161391373) has the molecular formula C39H36BrN and a molecular weight of 598.63 g/mol. Its IUPAC name is 1-bromo-4-phenylbenzene;4-methylaniline;1-methyl-4-[(4-phenylphenyl)methyl]benzene.
| Compound Name | 1-bromo-4-phenylbenzene;4-methylaniline;1-methyl-4-[(4-phenylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 161391373 |
| Molecular Formula | C39H36BrN |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 1-bromo-4-phenylbenzene;4-methylaniline;1-methyl-4-[(4-phenylphenyl)methyl]benzene |
| SMILES | Brc1ccc(-c2ccccc2)cc1.Cc1ccc(Cc2ccc(-c3ccccc3)cc2)cc1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C20H18.C12H9Br.C7H9N/c1-16-7-9-17(10-8-16)15-18-11-13-20(14-12-18)19-5-3-2-4-6-19;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-6-2-4-7(8)5-3-6/h2-14H,15H2,1H3;1-9H;2-5H,8H2,1H3 |
| InChIKey | VTALAWHMMJLBCZ-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|