About 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline
4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline (PubChem CID 22262965) has the molecular formula C25H26N4
and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline |
| PubChem CID | 22262965 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1.Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H14N2.C12H12N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,9,14-15H2;1-8H,13-14H2 |
| InChIKey | ALRXNVSZLYANIV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline?
The IUPAC name of 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline (CID 22262965) is 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline.
What is the SMILES notation for 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline?
The canonical SMILES for 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline is Nc1ccc(-c2ccc(N)cc2)cc1.Nc1ccc(Cc2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline?
The InChIKey is ALRXNVSZLYANIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.C12H12N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,9,14-15H2;1-8H,13-14H2.
What are the key properties of 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline?
4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline has a molecular weight of 382.51 g/mol, XLogP of 4.96, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;4-[(4-aminophenyl)methyl]aniline is sourced from PubChem (CID 22262965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).