C13H15N3 — CID 22022535
4-[(4-aminophenyl)methyl]benzene-1,2-diamine (PubChem CID 22022535) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]benzene-1,2-diamine.
| Compound Name | 4-[(4-aminophenyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 22022535 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(Cc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C13H15N3/c14-11-4-1-9(2-5-11)7-10-3-6-12(15)13(16)8-10/h1-6,8H,7,14-16H2 |
| InChIKey | LVKDOSFXVMTFKD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|