C13H18Cl3N3 — CID 18353599
4-[(3-aminophenyl)methyl]benzene-1,2-diamine;trihydrochloride (PubChem CID 18353599) has the molecular formula C13H18Cl3N3 and a molecular weight of 322.67 g/mol. Its IUPAC name is 4-[(3-aminophenyl)methyl]benzene-1,2-diamine;trihydrochloride.
| Compound Name | 4-[(3-aminophenyl)methyl]benzene-1,2-diamine;trihydrochloride |
|---|---|
| PubChem CID | 18353599 |
| Molecular Formula | C13H18Cl3N3 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-[(3-aminophenyl)methyl]benzene-1,2-diamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.Nc1cccc(Cc2ccc(N)c(N)c2)c1 |
| InChI | InChI=1S/C13H15N3.3ClH/c14-11-3-1-2-9(7-11)6-10-4-5-12(15)13(16)8-10;;;/h1-5,7-8H,6,14-16H2;3*1H |
| InChIKey | GYYJSAOKXJIKKY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|