C12H13N3 — CID 13276723
4-(pyridin-3-ylmethyl)benzene-1,2-diamine (PubChem CID 13276723) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-(pyridin-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-(pyridin-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 13276723 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-(pyridin-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Cc2cccnc2)cc1N |
| InChI | InChI=1S/C12H13N3/c13-11-4-3-9(7-12(11)14)6-10-2-1-5-15-8-10/h1-5,7-8H,6,13-14H2 |
| InChIKey | ATAHVSGFRKXTFY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|