C7H11ClN2O — CID 174554686
(3,4-diaminophenyl)methanol;hydrochloride (PubChem CID 174554686) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is (3,4-diaminophenyl)methanol;hydrochloride.
| Compound Name | (3,4-diaminophenyl)methanol;hydrochloride |
|---|---|
| PubChem CID | 174554686 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (3,4-diaminophenyl)methanol;hydrochloride |
| SMILES | Cl.Nc1ccc(CO)cc1N |
| InChI | InChI=1S/C7H10N2O.ClH/c8-6-2-1-5(4-10)3-7(6)9;/h1-3,10H,4,8-9H2;1H |
| InChIKey | PIWYXMVAVUSIML-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|