C11H19N3O2 — CID 94810816
2-[(3,4-diaminophenyl)methyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 94810816) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[(3,4-diaminophenyl)methyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[(3,4-diaminophenyl)methyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 94810816 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-[(3,4-diaminophenyl)methyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | Nc1ccc(CN(CCO)CCO)cc1N |
| InChI | InChI=1S/C11H19N3O2/c12-10-2-1-9(7-11(10)13)8-14(3-5-15)4-6-16/h1-2,7,15-16H,3-6,8,12-13H2 |
| InChIKey | ZUNPDTJGXDDSQN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|