C13H23NO8P2 — CID 155789741
[4-[[bis(2-hydroxyethyl)amino]methyl]-2-(phosphonomethyl)phenyl]methylphosphonic acid (PubChem CID 155789741) has the molecular formula C13H23NO8P2 and a molecular weight of 383.27 g/mol. Its IUPAC name is [4-[[bis(2-hydroxyethyl)amino]methyl]-2-(phosphonomethyl)phenyl]methylphosphonic acid.
| Compound Name | [4-[[bis(2-hydroxyethyl)amino]methyl]-2-(phosphonomethyl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 155789741 |
| Molecular Formula | C13H23NO8P2 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [4-[[bis(2-hydroxyethyl)amino]methyl]-2-(phosphonomethyl)phenyl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1ccc(CN(CCO)CCO)cc1CP(=O)(O)O |
| InChI | InChI=1S/C13H23NO8P2/c15-5-3-14(4-6-16)8-11-1-2-12(9-23(17,18)19)13(7-11)10-24(20,21)22/h1-2,7,15-16H,3-6,8-10H2,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | MHCWHOXJSRIWCU-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|