C8H12O8P2 — CID 102313715
[2,3-dihydroxy-4-(phosphonomethyl)phenyl]methylphosphonic acid (PubChem CID 102313715) has the molecular formula C8H12O8P2 and a molecular weight of 298.12 g/mol. Its IUPAC name is [2,3-dihydroxy-4-(phosphonomethyl)phenyl]methylphosphonic acid.
| Compound Name | [2,3-dihydroxy-4-(phosphonomethyl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 102313715 |
| Molecular Formula | C8H12O8P2 |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | [2,3-dihydroxy-4-(phosphonomethyl)phenyl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1ccc(CP(=O)(O)O)c(O)c1O |
| InChI | InChI=1S/C8H12O8P2/c9-7-5(3-17(11,12)13)1-2-6(8(7)10)4-18(14,15)16/h1-2,9-10H,3-4H2,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | HQRALSSBAQSWLV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|