C12H14O6P2 — CID 102099727
[5-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid (PubChem CID 102099727) has the molecular formula C12H14O6P2 and a molecular weight of 316.19 g/mol. Its IUPAC name is [5-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid.
| Compound Name | [5-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 102099727 |
| Molecular Formula | C12H14O6P2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | [5-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1cccc2c(CP(=O)(O)O)cccc12 |
| InChI | InChI=1S/C12H14O6P2/c13-19(14,15)7-9-3-1-5-11-10(8-20(16,17)18)4-2-6-12(9)11/h1-6H,7-8H2,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | LUARLBUDLFYMTF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|