C14H18O6P2 — CID 88666663
[2-(naphthalen-1-ylmethyl)-3-phosphonopropyl]phosphonic acid (PubChem CID 88666663) has the molecular formula C14H18O6P2 and a molecular weight of 344.24 g/mol. Its IUPAC name is [2-(naphthalen-1-ylmethyl)-3-phosphonopropyl]phosphonic acid.
| Compound Name | [2-(naphthalen-1-ylmethyl)-3-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 88666663 |
| Molecular Formula | C14H18O6P2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [2-(naphthalen-1-ylmethyl)-3-phosphonopropyl]phosphonic acid |
| SMILES | O=P(O)(O)CC(Cc1cccc2ccccc12)CP(=O)(O)O |
| InChI | InChI=1S/C14H18O6P2/c15-21(16,17)9-11(10-22(18,19)20)8-13-6-3-5-12-4-1-2-7-14(12)13/h1-7,11H,8-10H2,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | FNIDHFKBHKBCKY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|