C11H18O7P2 — CID 58454956
[2-(ethoxymethyl)-3-(phosphonomethyl)phenyl]methylphosphonic acid (PubChem CID 58454956) has the molecular formula C11H18O7P2 and a molecular weight of 324.21 g/mol. Its IUPAC name is [2-(ethoxymethyl)-3-(phosphonomethyl)phenyl]methylphosphonic acid.
| Compound Name | [2-(ethoxymethyl)-3-(phosphonomethyl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 58454956 |
| Molecular Formula | C11H18O7P2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [2-(ethoxymethyl)-3-(phosphonomethyl)phenyl]methylphosphonic acid |
| SMILES | CCOCc1c(CP(=O)(O)O)cccc1CP(=O)(O)O |
| InChI | InChI=1S/C11H18O7P2/c1-2-18-6-11-9(7-19(12,13)14)4-3-5-10(11)8-20(15,16)17/h3-5H,2,6-8H2,1H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | QKKCGRSGBMVXLA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|