C20H30O7P2 — CID 154322233
[4-octoxy-8-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid (PubChem CID 154322233) has the molecular formula C20H30O7P2 and a molecular weight of 444.40 g/mol. Its IUPAC name is [4-octoxy-8-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid.
| Compound Name | [4-octoxy-8-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 154322233 |
| Molecular Formula | C20H30O7P2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [4-octoxy-8-(phosphonomethyl)naphthalen-1-yl]methylphosphonic acid |
| SMILES | CCCCCCCCOc1ccc(CP(=O)(O)O)c2c(CP(=O)(O)O)cccc12 |
| InChI | InChI=1S/C20H30O7P2/c1-2-3-4-5-6-7-13-27-19-12-11-17(15-29(24,25)26)20-16(14-28(21,22)23)9-8-10-18(19)20/h8-12H,2-7,13-15H2,1H3,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | CWHYSQLFQCNNRO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|