C21H32NO4P — CID 118469125
3-[(4-heptoxynaphthalen-1-yl)methylamino]propylphosphonic acid (PubChem CID 118469125) has the molecular formula C21H32NO4P and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-[(4-heptoxynaphthalen-1-yl)methylamino]propylphosphonic acid.
| Compound Name | 3-[(4-heptoxynaphthalen-1-yl)methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 118469125 |
| Molecular Formula | C21H32NO4P |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-[(4-heptoxynaphthalen-1-yl)methylamino]propylphosphonic acid |
| SMILES | CCCCCCCOc1ccc(CNCCCP(=O)(O)O)c2ccccc12 |
| InChI | InChI=1S/C21H32NO4P/c1-2-3-4-5-8-15-26-21-13-12-18(19-10-6-7-11-20(19)21)17-22-14-9-16-27(23,24)25/h6-7,10-13,22H,2-5,8-9,14-17H2,1H3,(H2,23,24,25) |
| InChIKey | MNPSIAUMGSRTKN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|