C18H30Br2NO4P — CID 10289318
3-[(3,5-dibromo-4-octoxyphenyl)methylamino]propylphosphonic acid (PubChem CID 10289318) has the molecular formula C18H30Br2NO4P and a molecular weight of 515.22 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-octoxyphenyl)methylamino]propylphosphonic acid.
| Compound Name | 3-[(3,5-dibromo-4-octoxyphenyl)methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 10289318 |
| Molecular Formula | C18H30Br2NO4P |
| Molecular Weight | 515.22 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | 3-[(3,5-dibromo-4-octoxyphenyl)methylamino]propylphosphonic acid |
| SMILES | CCCCCCCCOc1c(Br)cc(CNCCCP(=O)(O)O)cc1Br |
| InChI | InChI=1S/C18H30Br2NO4P/c1-2-3-4-5-6-7-10-25-18-16(19)12-15(13-17(18)20)14-21-9-8-11-26(22,23)24/h12-13,21H,2-11,14H2,1H3,(H2,22,23,24) |
| InChIKey | GCTZIVJBMHYJOP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.22 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|