C17H27Br2NO — CID 107743874
N-[(3,5-dibromo-4-hexoxyphenyl)methyl]-2-methylpropan-1-amine (PubChem CID 107743874) has the molecular formula C17H27Br2NO and a molecular weight of 421.22 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hexoxyphenyl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(3,5-dibromo-4-hexoxyphenyl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107743874 |
| Molecular Formula | C17H27Br2NO |
| Molecular Weight | 421.22 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | N-[(3,5-dibromo-4-hexoxyphenyl)methyl]-2-methylpropan-1-amine |
| SMILES | CCCCCCOc1c(Br)cc(CNCC(C)C)cc1Br |
| InChI | InChI=1S/C17H27Br2NO/c1-4-5-6-7-8-21-17-15(18)9-14(10-16(17)19)12-20-11-13(2)3/h9-10,13,20H,4-8,11-12H2,1-3H3 |
| InChIKey | RXEYAKMTBKSGAJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.22 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|