C15H20Br2N2O — CID 107743953
4-[2,6-dibromo-4-[(2-methylpropylamino)methyl]phenoxy]butanenitrile (PubChem CID 107743953) has the molecular formula C15H20Br2N2O and a molecular weight of 404.15 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-[(2-methylpropylamino)methyl]phenoxy]butanenitrile.
| Compound Name | 4-[2,6-dibromo-4-[(2-methylpropylamino)methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 107743953 |
| Molecular Formula | C15H20Br2N2O |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 4-[2,6-dibromo-4-[(2-methylpropylamino)methyl]phenoxy]butanenitrile |
| SMILES | CC(C)CNCc1cc(Br)c(OCCCC#N)c(Br)c1 |
| InChI | InChI=1S/C15H20Br2N2O/c1-11(2)9-19-10-12-7-13(16)15(14(17)8-12)20-6-4-3-5-18/h7-8,11,19H,3-4,6,9-10H2,1-2H3 |
| InChIKey | WBBPEOOLWFKWGA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|