C17H25BrN2O — CID 115961536
5-[4-bromo-2-methyl-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile (PubChem CID 115961536) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-[4-bromo-2-methyl-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile.
| Compound Name | 5-[4-bromo-2-methyl-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile |
|---|---|
| PubChem CID | 115961536 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-[4-bromo-2-methyl-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile |
| SMILES | Cc1cc(Br)cc(CNCC(C)C)c1OCCCCC#N |
| InChI | InChI=1S/C17H25BrN2O/c1-13(2)11-20-12-15-10-16(18)9-14(3)17(15)21-8-6-4-5-7-19/h9-10,13,20H,4-6,8,11-12H2,1-3H3 |
| InChIKey | KZYTUIRPSOGJDA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|