C16H22Cl2N2O — CID 63058137
5-[2,4-dichloro-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile (PubChem CID 63058137) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 5-[2,4-dichloro-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile.
| Compound Name | 5-[2,4-dichloro-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile |
|---|---|
| PubChem CID | 63058137 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-[2,4-dichloro-6-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile |
| SMILES | CC(C)CNCc1cc(Cl)cc(Cl)c1OCCCCC#N |
| InChI | InChI=1S/C16H22Cl2N2O/c1-12(2)10-20-11-13-8-14(17)9-15(18)16(13)21-7-5-3-4-6-19/h8-9,12,20H,3-5,7,10-11H2,1-2H3 |
| InChIKey | WLFQEOZJQJZMGC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|