C11H12Cl2N2O — CID 60888481
4-[2-(aminomethyl)-4,6-dichlorophenoxy]butanenitrile (PubChem CID 60888481) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-4,6-dichlorophenoxy]butanenitrile.
| Compound Name | 4-[2-(aminomethyl)-4,6-dichlorophenoxy]butanenitrile |
|---|---|
| PubChem CID | 60888481 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-[2-(aminomethyl)-4,6-dichlorophenoxy]butanenitrile |
| SMILES | N#CCCCOc1c(Cl)cc(Cl)cc1CN |
| InChI | InChI=1S/C11H12Cl2N2O/c12-9-5-8(7-15)11(10(13)6-9)16-4-2-1-3-14/h5-6H,1-2,4,7,15H2 |
| InChIKey | XRFCELCZIIZINT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|