C15H23Cl2NO — CID 43515616
(3,5-dichloro-2-octoxyphenyl)methanamine (PubChem CID 43515616) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is (3,5-dichloro-2-octoxyphenyl)methanamine.
| Compound Name | (3,5-dichloro-2-octoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43515616 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (3,5-dichloro-2-octoxyphenyl)methanamine |
| SMILES | CCCCCCCCOc1c(Cl)cc(Cl)cc1CN |
| InChI | InChI=1S/C15H23Cl2NO/c1-2-3-4-5-6-7-8-19-15-12(11-18)9-13(16)10-14(15)17/h9-10H,2-8,11,18H2,1H3 |
| InChIKey | YZRMUBGMBRFMHN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|