C17H27Cl2NO — CID 63421467
2-(3,5-dichloro-2-nonoxyphenyl)ethanamine (PubChem CID 63421467) has the molecular formula C17H27Cl2NO and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-nonoxyphenyl)ethanamine.
| Compound Name | 2-(3,5-dichloro-2-nonoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 63421467 |
| Molecular Formula | C17H27Cl2NO |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(3,5-dichloro-2-nonoxyphenyl)ethanamine |
| SMILES | CCCCCCCCCOc1c(Cl)cc(Cl)cc1CCN |
| InChI | InChI=1S/C17H27Cl2NO/c1-2-3-4-5-6-7-8-11-21-17-14(9-10-20)12-15(18)13-16(17)19/h12-13H,2-11,20H2,1H3 |
| InChIKey | NUFAJRYUHXRGSU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|