C11H14Cl2FNO — CID 81114613
2-[3,5-dichloro-2-(3-fluoropropoxy)phenyl]ethanamine (PubChem CID 81114613) has the molecular formula C11H14Cl2FNO and a molecular weight of 266.14 g/mol. Its IUPAC name is 2-[3,5-dichloro-2-(3-fluoropropoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-dichloro-2-(3-fluoropropoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 81114613 |
| Molecular Formula | C11H14Cl2FNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-[3,5-dichloro-2-(3-fluoropropoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(Cl)cc(Cl)c1OCCCF |
| InChI | InChI=1S/C11H14Cl2FNO/c12-9-6-8(2-4-15)11(10(13)7-9)16-5-1-3-14/h6-7H,1-5,15H2 |
| InChIKey | KCACKFUWXDUBJW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|