C12H16Cl2FNO — CID 81107142
N-[[3,5-dichloro-2-(3-fluoropropoxy)phenyl]methyl]ethanamine (PubChem CID 81107142) has the molecular formula C12H16Cl2FNO and a molecular weight of 280.17 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-(3-fluoropropoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-dichloro-2-(3-fluoropropoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 81107142 |
| Molecular Formula | C12H16Cl2FNO |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-[[3,5-dichloro-2-(3-fluoropropoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)cc(Cl)c1OCCCF |
| InChI | InChI=1S/C12H16Cl2FNO/c1-2-16-8-9-6-10(13)7-11(14)12(9)17-5-3-4-15/h6-7,16H,2-5,8H2,1H3 |
| InChIKey | GTGILPXYKLFNMX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|