C15H23Cl2NO3 — CID 103177633
N-[[3,5-dichloro-2-[2-(3-methoxypropoxy)ethoxy]phenyl]methyl]ethanamine (PubChem CID 103177633) has the molecular formula C15H23Cl2NO3 and a molecular weight of 336.26 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-[2-(3-methoxypropoxy)ethoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-dichloro-2-[2-(3-methoxypropoxy)ethoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103177633 |
| Molecular Formula | C15H23Cl2NO3 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[[3,5-dichloro-2-[2-(3-methoxypropoxy)ethoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)cc(Cl)c1OCCOCCCOC |
| InChI | InChI=1S/C15H23Cl2NO3/c1-3-18-11-12-9-13(16)10-14(17)15(12)21-8-7-20-6-4-5-19-2/h9-10,18H,3-8,11H2,1-2H3 |
| InChIKey | UMDRRBFEXPPXEV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|