C16H26Cl3NO2 — CID 17207804
3-butoxy-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 17207804) has the molecular formula C16H26Cl3NO2 and a molecular weight of 370.75 g/mol. Its IUPAC name is 3-butoxy-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-butoxy-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17207804 |
| Molecular Formula | C16H26Cl3NO2 |
| Molecular Weight | 370.75 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-butoxy-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | CCCCOCCCNCc1cc(Cl)cc(Cl)c1OCC.Cl |
| InChI | InChI=1S/C16H25Cl2NO2.ClH/c1-3-5-8-20-9-6-7-19-12-13-10-14(17)11-15(18)16(13)21-4-2;/h10-11,19H,3-9,12H2,1-2H3;1H |
| InChIKey | FTAHSZJWTVTTFU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|