C17H19Cl4NO — CID 17208622
2-(4-chlorophenyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17208622) has the molecular formula C17H19Cl4NO and a molecular weight of 395.16 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17208622 |
| Molecular Formula | C17H19Cl4NO |
| Molecular Weight | 395.16 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3,5-dichloro-2-ethoxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CNCCc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H18Cl3NO.ClH/c1-2-22-17-13(9-15(19)10-16(17)20)11-21-8-7-12-3-5-14(18)6-4-12;/h3-6,9-10,21H,2,7-8,11H2,1H3;1H |
| InChIKey | KKGCIKWRMDCZEY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.16 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|