C18H21Cl2NO — CID 35697832
N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 35697832) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 35697832 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Cl)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-3-8-21-11-15-9-16(19)10-17(20)18(15)22-12-14-6-4-13(2)5-7-14/h4-7,9-10,21H,3,8,11-12H2,1-2H3 |
| InChIKey | MZIXNDWYWROEBK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|