C20H26Cl2N2O — CID 35697888
N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 35697888) has the molecular formula C20H26Cl2N2O and a molecular weight of 381.35 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 35697888 |
| Molecular Formula | C20H26Cl2N2O |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1ccc(COc2c(Cl)cc(Cl)cc2CNCCCN(C)C)cc1 |
| InChI | InChI=1S/C20H26Cl2N2O/c1-15-5-7-16(8-6-15)14-25-20-17(11-18(21)12-19(20)22)13-23-9-4-10-24(2)3/h5-8,11-12,23H,4,9-10,13-14H2,1-3H3 |
| InChIKey | PNDNQJRBXDKKRA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|