C19H24BrClN2O — CID 17057017
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 17057017) has the molecular formula C19H24BrClN2O and a molecular weight of 411.77 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17057017 |
| Molecular Formula | C19H24BrClN2O |
| Molecular Weight | 411.77 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1ccc(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C19H24BrClN2O/c1-23(2)11-3-10-22-13-16-6-9-19(18(20)12-16)24-14-15-4-7-17(21)8-5-15/h4-9,12,22H,3,10-11,13-14H2,1-2H3 |
| InChIKey | WSUYDZDEVOQANK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|