C20H21BrClN3O — CID 17156644
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 17156644) has the molecular formula C20H21BrClN3O and a molecular weight of 434.77 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 17156644 |
| Molecular Formula | C20H21BrClN3O |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | Clc1ccc(COc2ccc(CNCCCn3ccnc3)cc2Br)cc1 |
| InChI | InChI=1S/C20H21BrClN3O/c21-19-12-17(13-23-8-1-10-25-11-9-24-15-25)4-7-20(19)26-14-16-2-5-18(22)6-3-16/h2-7,9,11-12,15,23H,1,8,10,13-14H2 |
| InChIKey | UGLHWGHMOWTHTJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|