C21H22BrCl2N3O2 — CID 17156636
N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 17156636) has the molecular formula C21H22BrCl2N3O2 and a molecular weight of 499.24 g/mol. Its IUPAC name is N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 17156636 |
| Molecular Formula | C21H22BrCl2N3O2 |
| Molecular Weight | 499.24 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | COc1cc(CNCCCn2ccnc2)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H22BrCl2N3O2/c1-28-20-11-16(12-25-5-2-7-27-8-6-26-14-27)9-17(22)21(20)29-13-15-3-4-18(23)19(24)10-15/h3-4,6,8-11,14,25H,2,5,7,12-13H2,1H3 |
| InChIKey | XBDBOMVMONKUQL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.24 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|