C21H24BrCl2N3O2 — CID 17155333
N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride (PubChem CID 17155333) has the molecular formula C21H24BrCl2N3O2 and a molecular weight of 501.25 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17155333 |
| Molecular Formula | C21H24BrCl2N3O2 |
| Molecular Weight | 501.25 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
| SMILES | COc1cc(CNCCCn2ccnc2)cc(Br)c1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C21H23BrClN3O2.ClH/c1-27-20-12-16(13-24-7-4-9-26-10-8-25-15-26)11-18(22)21(20)28-14-17-5-2-3-6-19(17)23;/h2-3,5-6,8,10-12,15,24H,4,7,9,13-14H2,1H3;1H |
| InChIKey | XQUZJWTZBXDICI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.25 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|