C22H25Cl2N3O2 — CID 17155429
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 17155429) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 17155429 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CCOc1cc(CNCCCn2ccnc2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-2-28-21-13-17(14-25-8-5-10-27-11-9-26-16-27)12-20(24)22(21)29-15-18-6-3-4-7-19(18)23/h3-4,6-7,9,11-13,16,25H,2,5,8,10,14-15H2,1H3 |
| InChIKey | ZDMHXMIWYHPUMR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|