C20H24Cl2N4O2 — CID 17156579
N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride (PubChem CID 17156579) has the molecular formula C20H24Cl2N4O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride.
| Compound Name | N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156579 |
| Molecular Formula | C20H24Cl2N4O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
| SMILES | COc1cc(CNCCCn2ccnc2)cc(Cl)c1OCc1cccnc1.Cl |
| InChI | InChI=1S/C20H23ClN4O2.ClH/c1-26-19-11-17(13-23-6-3-8-25-9-7-24-15-25)10-18(21)20(19)27-14-16-4-2-5-22-12-16;/h2,4-5,7,9-12,15,23H,3,6,8,13-14H2,1H3;1H |
| InChIKey | VLUUKXHLPWOUEN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|