C21H25N3O3 — CID 35591627
N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]-2-imidazol-1-ylethanamine (PubChem CID 35591627) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]-2-imidazol-1-ylethanamine.
| Compound Name | N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]-2-imidazol-1-ylethanamine |
|---|---|
| PubChem CID | 35591627 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]-2-imidazol-1-ylethanamine |
| SMILES | COc1cc(CNCCn2ccnc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O3/c1-25-19-12-18(14-22-8-10-24-11-9-23-16-24)13-20(26-2)21(19)27-15-17-6-4-3-5-7-17/h3-7,9,11-13,16,22H,8,10,14-15H2,1-2H3 |
| InChIKey | JJVQISKXNXORPF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|