C21H23BrClN3O2 — CID 17155332
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 17155332) has the molecular formula C21H23BrClN3O2 and a molecular weight of 464.79 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 17155332 |
| Molecular Formula | C21H23BrClN3O2 |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | COc1cc(CNCCCn2ccnc2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23BrClN3O2/c1-27-20-12-17(13-24-7-2-9-26-10-8-25-15-26)11-19(22)21(20)28-14-16-3-5-18(23)6-4-16/h3-6,8,10-12,15,24H,2,7,9,13-14H2,1H3 |
| InChIKey | RFCVIZSKYWQTFF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|