C18H25Cl3N2O2 — CID 17055928
N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]butan-1-amine;dihydrochloride (PubChem CID 17055928) has the molecular formula C18H25Cl3N2O2 and a molecular weight of 407.77 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]butan-1-amine;dihydrochloride.
| Compound Name | N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]butan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17055928 |
| Molecular Formula | C18H25Cl3N2O2 |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]butan-1-amine;dihydrochloride |
| SMILES | CCCCNCc1cc(Cl)c(OCc2cccnc2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C18H23ClN2O2.2ClH/c1-3-4-7-20-12-15-9-16(19)18(17(10-15)22-2)23-13-14-6-5-8-21-11-14;;/h5-6,8-11,20H,3-4,7,12-13H2,1-2H3;2*1H |
| InChIKey | DHYQRRYHGRFAKN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|