C22H30ClNO2 — CID 4716931
N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]heptan-1-amine (PubChem CID 4716931) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]heptan-1-amine.
| Compound Name | N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]heptan-1-amine |
|---|---|
| PubChem CID | 4716931 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1cc(Cl)c(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H30ClNO2/c1-3-4-5-6-10-13-24-16-19-14-20(23)22(21(15-19)25-2)26-17-18-11-8-7-9-12-18/h7-9,11-12,14-15,24H,3-6,10,13,16-17H2,1-2H3 |
| InChIKey | KFISNMDTOQVROJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|