C20H25Cl4NO2 — CID 17291021
N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]pentan-1-amine;hydrochloride (PubChem CID 17291021) has the molecular formula C20H25Cl4NO2 and a molecular weight of 453.24 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]pentan-1-amine;hydrochloride.
| Compound Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291021 |
| Molecular Formula | C20H25Cl4NO2 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]pentan-1-amine;hydrochloride |
| SMILES | CCCCCNCc1cc(Cl)c(OCc2ccc(Cl)cc2Cl)c(OC)c1.Cl |
| InChI | InChI=1S/C20H24Cl3NO2.ClH/c1-3-4-5-8-24-12-14-9-18(23)20(19(10-14)25-2)26-13-15-6-7-16(21)11-17(15)22;/h6-7,9-11,24H,3-5,8,12-13H2,1-2H3;1H |
| InChIKey | VYNQDHREIBXDEN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|