C19H23Cl3N2O2 — CID 4720885
N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 4720885) has the molecular formula C19H23Cl3N2O2 and a molecular weight of 417.76 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 4720885 |
| Molecular Formula | C19H23Cl3N2O2 |
| Molecular Weight | 417.76 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | COc1cc(CNCCN(C)C)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H23Cl3N2O2/c1-24(2)7-6-23-11-13-8-17(22)19(18(9-13)25-3)26-12-14-4-5-15(20)10-16(14)21/h4-5,8-10,23H,6-7,11-12H2,1-3H3 |
| InChIKey | UGSKUBZVQBGNSB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|