C23H32Cl3NO2 — CID 17331190
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine;hydrochloride (PubChem CID 17331190) has the molecular formula C23H32Cl3NO2 and a molecular weight of 460.87 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine;hydrochloride.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17331190 |
| Molecular Formula | C23H32Cl3NO2 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]octan-1-amine;hydrochloride |
| SMILES | CCCCCCCCNCc1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1.Cl |
| InChI | InChI=1S/C23H31Cl2NO2.ClH/c1-3-4-5-6-7-8-13-26-16-18-9-12-22(23(14-18)27-2)28-17-19-10-11-20(24)15-21(19)25;/h9-12,14-15,26H,3-8,13,16-17H2,1-2H3;1H |
| InChIKey | WYGREFSXQRFTQV-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|