C21H27ClFNO2 — CID 4719476
N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine (PubChem CID 4719476) has the molecular formula C21H27ClFNO2 and a molecular weight of 379.90 g/mol. Its IUPAC name is N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine.
| Compound Name | N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 4719476 |
| Molecular Formula | C21H27ClFNO2 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1ccc(OCc2ccc(F)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C21H27ClFNO2/c1-3-4-5-6-11-24-14-16-7-10-20(21(12-16)25-2)26-15-17-8-9-18(23)13-19(17)22/h7-10,12-13,24H,3-6,11,14-15H2,1-2H3 |
| InChIKey | AGYKHINJEPCYDP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|