C22H28BrClFNO2 — CID 66534876
N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine (PubChem CID 66534876) has the molecular formula C22H28BrClFNO2 and a molecular weight of 472.83 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine.
| Compound Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine |
|---|---|
| PubChem CID | 66534876 |
| Molecular Formula | C22H28BrClFNO2 |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1cc(OC)c(OCc2ccc(F)cc2Cl)cc1Br |
| InChI | InChI=1S/C22H28BrClFNO2/c1-3-4-5-6-7-10-26-14-17-11-21(27-2)22(13-19(17)23)28-15-16-8-9-18(25)12-20(16)24/h8-9,11-13,26H,3-7,10,14-15H2,1-2H3 |
| InChIKey | ZRMMIMWEVGJYLP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|