C21H26BrClFNO3 — CID 66533236
N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine (PubChem CID 66533236) has the molecular formula C21H26BrClFNO3 and a molecular weight of 474.80 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 66533236 |
| Molecular Formula | C21H26BrClFNO3 |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1cc(OCC)c(OCc2ccc(F)cc2Cl)cc1Br |
| InChI | InChI=1S/C21H26BrClFNO3/c1-3-26-9-5-8-25-13-16-10-20(27-4-2)21(12-18(16)22)28-14-15-6-7-17(24)11-19(15)23/h6-7,10-12,25H,3-5,8-9,13-14H2,1-2H3 |
| InChIKey | JYNAJDNGXHMBPF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|