C24H30BrClFNO2 — CID 66533181
N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]cyclooctanamine (PubChem CID 66533181) has the molecular formula C24H30BrClFNO2 and a molecular weight of 498.86 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]cyclooctanamine.
| Compound Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]cyclooctanamine |
|---|---|
| PubChem CID | 66533181 |
| Molecular Formula | C24H30BrClFNO2 |
| Molecular Weight | 498.86 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]cyclooctanamine |
| SMILES | CCOc1cc(CNC2CCCCCCC2)c(Br)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H30BrClFNO2/c1-2-29-23-12-18(15-28-20-8-6-4-3-5-7-9-20)21(25)14-24(23)30-16-17-10-11-19(27)13-22(17)26/h10-14,20,28H,2-9,15-16H2,1H3 |
| InChIKey | ASJKUQKZFANYEF-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.86 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |